4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid structure
|
Common Name | 4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 701917-03-5 | Molecular Weight | 233.18000 | |
| Density | N/A | Boiling Point | 455.1±30.0°C | |
| Molecular Formula | C10H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 455.1±30.0°C |
|---|---|
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18000 |
| Exact Mass | 233.04400 |
| PSA | 100.94000 |
| LogP | 2.00190 |
| InChIKey | HZENRRKFQYHSJU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nn(-c2ccccc2)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~97%
4-Nitro-1-pheny... CAS#:701917-03-5 |
| Literature: MERCK and CO., INC.; ATON PHARMA, INC. Patent: WO2007/2248 A2, 2007 ; Location in patent: Page/Page column 92 ; WO 2007/002248 A2 |
|
~86%
4-Nitro-1-pheny... CAS#:701917-03-5 |
| Literature: F. HOFFMANN-LA ROCHE AG; BLEICHER, Konrad; FLOHR, Alexander; GROEBKE ZBINDEN, Katrin; GRUBER, Felix; KOERNER, Matthias; KUHN, Bernd; PETERS, Jens-Uwe; RODRIGUEZ SARMIENTO, Rosa Maria Patent: WO2011/154327 A1, 2011 ; Location in patent: Page/Page column 135 ; WO 2011/154327 A1 |
|
~%
4-Nitro-1-pheny... CAS#:701917-03-5 |
| Literature: MERCK and CO., INC. Patent: WO2007/55941 A2, 2007 ; WO 2007/055941 A2 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole-3-carboxylic acid,4-nitro-1-phenyl |
| 4-nitro-1-phenyl-1H-pyrazole-3-carboxylic acid |