3-Oxobetulin structure
|
Common Name | 3-Oxobetulin | ||
|---|---|---|---|---|
| CAS Number | 7020-34-0 | Molecular Weight | 440.70100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Oxobetulin3-Oxobetulin, an antifungal agent, shows antifungal activities against white rot fungus L. betulina and the brown rot fungus L. sulphureus[1]. |
| Name | 28-hydroxylup-20(29)-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Oxobetulin, an antifungal agent, shows antifungal activities against white rot fungus L. betulina and the brown rot fungus L. sulphureus[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H48O2 |
|---|---|
| Molecular Weight | 440.70100 |
| Exact Mass | 440.36500 |
| PSA | 37.30000 |
| LogP | 7.20540 |
| InChIKey | JYDNKGUBLIKNAM-CNRMHUMKSA-N |
| SMILES | C=C(C)C1CCC2(CO)CCC3(C)C(CCC4C5(C)CCC(=O)C(C)(C)C5CCC43C)C12 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| betulone aldehyde |
| lup-20(29)-ene-3-on-28-ol |
| Betulone |
| lup-20(29)-en-3-on-28-ol |
| 28-hydroxylup-20(29)-3-one |