CP 50556-1 hydrochloride structure
|
Common Name | CP 50556-1 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 70222-86-5 | Molecular Weight | 474.03 | |
| Density | N/A | Boiling Point | 591.7ºC at 760 mmHg | |
| Molecular Formula | C27H36ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.7ºC | |
Use of CP 50556-1 hydrochlorideLevonantradol (l-Nantradol) hydrochloride is an analog of delta (9)-tetrahydrocannabinol. Levonantradol acting as a potent anti-analgesic agent[1]. |
| Name | [(6S,6aR,9R,10aR)-9-hydroxy-6-methyl-3-[(2R)-5-phenylpentan-2-yl]oxy-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Levonantradol (l-Nantradol) hydrochloride is an analog of delta (9)-tetrahydrocannabinol. Levonantradol acting as a potent anti-analgesic agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 591.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C27H36ClNO4 |
| Molecular Weight | 474.03 |
| Flash Point | 311.7ºC |
| Exact Mass | 473.23300 |
| PSA | 67.79000 |
| LogP | 6.40070 |
| InChIKey | NSOGAHPJIFTUHV-YINRMENDSA-N |
| SMILES | CC(=O)Oc1cc(OC(C)CCCc2ccccc2)cc2c1C1CC(O)CCC1C(C)N2.Cl |
| Levonantradol HCl |
| LEVONANTRADOL HYDROCHLORIDE |
| Levonantradol |