Pigment Red 48:2 structure
|
Common Name | Pigment Red 48:2 | ||
|---|---|---|---|---|
| CAS Number | 7023-61-2 | Molecular Weight | 458.88600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H11CaClN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Pigment Red 48:2 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H11CaClN2O6S |
|---|---|
| Molecular Weight | 458.88600 |
| Exact Mass | 457.96500 |
| PSA | 136.83000 |
| LogP | 5.52860 |
| InChIKey | KCAQGUXPIKJXTQ-UHFFFAOYSA-L |
| SMILES | Cc1cc(S(=O)(=O)[O-])c(N=Nc2c([O-])c(C(=O)O)cc3ccccc23)cc1Cl.[Ca+2] |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| MFCD00071945 |
| Pigment Red RC |
| Plasco red 48:2 |
| EINECS 230-303-5 |
| Permanent Red 2BS |
| Fast Red F5R |
| Red 2BP |
| PR48:2 RED 2B BS |
| Rubine Touer 2BA |
| PR48:2 CA RED 2B YS |