N,N-diethyl-4-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide structure
|
Common Name | N,N-diethyl-4-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7027-13-6 | Molecular Weight | 420.57200 | |
| Density | 1.36g/cm3 | Boiling Point | 597.4ºC at 760 mmHg | |
| Molecular Formula | C18H20N4O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.1ºC | |
| Name | N,N-diethyl-4-[2-[2-(thiophen-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 597.4ºC at 760 mmHg |
| Molecular Formula | C18H20N4O2S3 |
| Molecular Weight | 420.57200 |
| Flash Point | 315.1ºC |
| Exact Mass | 420.07500 |
| PSA | 139.52000 |
| LogP | 5.50190 |
| Index of Refraction | 1.673 |
| InChIKey | MCJYZHOHHGULKE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2csc(NN=Cc3cccs3)n2)cc1 |
|
~%
N,N-diethyl-4-[... CAS#:7027-13-6 |
| Literature: Sen; Bhargava Journal of the Indian Chemical Society, 1949 , vol. 26, p. 243 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Resorcin-bis(trichloracetat) |
| 1,3-bis-trichloroacetoxy-benzene |
| 1,3-Bis-trichloracetoxy-benzol |
| Bis-O-trichloracetyl-resorcin |