2,4(1H,3H)-Pyrimidinedione,6-amino-1,3-dimethyl-5-(4-morpholinylthioxomethyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-amino-1,3-dimethyl-5-(4-morpholinylthioxomethyl)- | ||
|---|---|---|---|---|
| CAS Number | 70425-09-1 | Molecular Weight | 284.33500 | |
| Density | 1.406g/cm3 | Boiling Point | 384.7ºC at 760mmHg | |
| Molecular Formula | C11H16N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | 6-amino-1,3-dimethyl-5-(morpholine-4-carbothioyl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 384.7ºC at 760mmHg |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.33500 |
| Flash Point | 186.5ºC |
| Exact Mass | 284.09400 |
| PSA | 114.58000 |
| Index of Refraction | 1.629 |
| InChIKey | XAYXKULSOBVYAU-UHFFFAOYSA-N |
| SMILES | Cn1c(N)c(C(=S)N2CCOCC2)c(=O)n(C)c1=O |
|
~%
2,4(1H,3H)-Pyri... CAS#:70425-09-1 |
| Literature: Tominaga; Machida; Okuda; Matsuda; Kobayashi Yakugaku zasshi : Journal of the Pharmaceutical Society of Japan, 1979 , vol. 99, # 5 p. 515 - 520 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(6-amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidine-5-carbothioyl)-morpholine |
| 6-Amino-1,3-dimethyl-5-(morpholino-thiocarbonyl)-uracil |