2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL structure
|
Common Name | 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL | ||
|---|---|---|---|---|
| CAS Number | 705-19-1 | Molecular Weight | 171.15400 | |
| Density | 1.45 g/cm3 | Boiling Point | 405.4ºC at 760 mmHg | |
| Molecular Formula | C6H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
Use of 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOLIsometronidazole is a hypoxic cell sensitizer. Isometronidazole (750 mg/kg) shows an efficacy as a hypoxic cell sensitizer in severely hypoxic FaDu tumors but not in less hypoxic GL tumors. |
| Name | 2-(2-methyl-4-nitroimidazol-1-yl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Description | Isometronidazole is a hypoxic cell sensitizer. Isometronidazole (750 mg/kg) shows an efficacy as a hypoxic cell sensitizer in severely hypoxic FaDu tumors but not in less hypoxic GL tumors. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.45 g/cm3 |
|---|---|
| Boiling Point | 405.4ºC at 760 mmHg |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.15400 |
| Flash Point | 199ºC |
| Exact Mass | 171.06400 |
| PSA | 83.87000 |
| LogP | 0.61520 |
| Index of Refraction | 1.612 |
| InChIKey | RSXWJXPKLRYMHW-UHFFFAOYSA-N |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCO |
|
~22%
2-(2-METHYL-4-N... CAS#:705-19-1 |
| Literature: Kim, Pilho; Zhang, Liang; Manjunatha, Ujjini H.; Singh, Ramandeep; Patel, Sejal; Jiricek, Jan; Keller, Thomas H.; Boshoff, Helena I.; Barry III, Clifton E.; Dowd, Cynthia S. Journal of Medicinal Chemistry, 2009 , vol. 52, # 5 p. 1317 - 1328 |
|
~93%
2-(2-METHYL-4-N... CAS#:705-19-1 |
| Literature: Liu; Chen; Cao; Li Synthetic Communications, 1993 , vol. 23, # 18 p. 2611 - 2615 |
| R.P. 8979 |
| Izoklion |
| 1H-Imidazole-1-ethanol,2-methyl-4-nitro |
| 2-methyl-4-nitroimidazole-1-ethanol |
| 2-Methyl-4-nitro-1H-imidazole-1-ethanol |
| Isometronidazole |
| 1-(2-hydroxyethyl)-2-methyl-4-nitro-1H-imidazole |
| 2-(2-Methyl-4-nitro-imidazol-1-yl)-ethanol |
| 2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethanol |
| Imidazole-1-ethanol,2-methyl-4-nitro |