N-[amino-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine structure
|
Common Name | N-[amino-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 70539-68-3 | Molecular Weight | 387.07000 | |
| Density | 1.6g/cm3 | Boiling Point | 393.2ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2F5N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | N-[amino-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760 mmHg |
| Molecular Formula | C10H10Cl2F5N2O2P |
| Molecular Weight | 387.07000 |
| Flash Point | 191.6ºC |
| Exact Mass | 385.97800 |
| PSA | 65.37000 |
| LogP | 4.30760 |
| Index of Refraction | 1.495 |
| InChIKey | SBNOQRYKHZVHPI-UHFFFAOYSA-N |
| SMILES | NP(=O)(Oc1c(F)c(F)c(F)c(F)c1F)N(CCCl)CCCl |
|
~%
N-[amino-(2,3,4... CAS#:70539-68-3 |
| Literature: Chiu,F.-T. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, p. 802 - 807 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |