4-butyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-butyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 70637-01-3 | Molecular Weight | 248.31700 | |
| Density | 1.126g/cm3 | Boiling Point | 326.2ºC at 760 mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.3ºC | |
| Name | 1-butyl-4-phenyl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 326.2ºC at 760 mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Flash Point | 109.3ºC |
| Exact Mass | 248.14100 |
| PSA | 27.69000 |
| LogP | 3.05050 |
| Index of Refraction | 1.536 |
| InChIKey | HKBXBUSPPGNWTA-UHFFFAOYSA-N |
| SMILES | CCCCC12COC(c3ccccc3)(OC1)OC2 |
| 4-BUTYL-1-PHENYL-2,6,7-TRIOXABICYCLO[2.2.2]OCTANE |
| Orthobenzoic acid,cyclic ester with 2-butyl-2-(hydroxymethyl)-1,3-propanediol |
| 2,6,7-Trioxabicyclo(2.2.2)octane,4-butyl-1-phenyl |