4-ethyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-ethyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 70637-02-4 | Molecular Weight | 220.26400 | |
| Density | 1.175g/cm3 | Boiling Point | 293.9ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.7ºC | |
| Name | 1-ethyl-4-phenyl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 293.9ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 97.7ºC |
| Exact Mass | 220.11000 |
| PSA | 27.69000 |
| LogP | 2.27030 |
| Index of Refraction | 1.547 |
| InChIKey | YXQANRITUWTASV-UHFFFAOYSA-N |
| SMILES | CCC12COC(c3ccccc3)(OC1)OC2 |
| 2,6,7-Trioxabicyclo(2.2.2)octane,4-ethyl-1-phenyl |
| Orthobenzoic acid,cyclic ester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol |
| 4-ETHYL-1-PHENYL-2,6,7-TRIOXABICYCLO[2.2.2]OCTANE |