6-(4-Methoxyphenyl)-4-oxo-2-thioxo-1,2,3,4-tetrahydro-5-pyrimidin ecarbonitrile structure
|
Common Name | 6-(4-Methoxyphenyl)-4-oxo-2-thioxo-1,2,3,4-tetrahydro-5-pyrimidin ecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 70638-54-9 | Molecular Weight | 259.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-Methoxyphenyl)-4-oxo-2-thioxo-1,2,3,4-tetrahydro-5-pyrimidin ecarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9N3O2S |
|---|---|
| Molecular Weight | 259.28400 |
| Exact Mass | 259.04200 |
| PSA | 117.83000 |
| LogP | 2.01818 |
| InChIKey | PXEWDUZAXRERFW-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2[nH]c(=S)[nH]c(=O)c2C#N)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 5-cyano-4-methylthiophen-2-yl-2-boronic acid |
| 5-cyano-6-(4-methoxyphenyl)-2-thiouracil |
| 5-cyano-6-(p-methoxyphenyl)-4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidine |
| 5-cyano-4-methylthiophene-2-boronic acid |
| 5-cyano-4-oxo-6-(4-methoxyphenyl)-2-thioxo-1,2,3,4-tetrahydropyrimidine |
| 5-cyano-6-(4-methoxyphenyl)-2-thioxo-1,2,3,4-tetrahydropyrimidin-4-one |
| 5-Cyano-6-(p-anisyl)-2-thiouracil |
| 6-(4-methoxy-phenyl)-4-oxo-2-thioxo-1,2,3,4-tetrahydro-pyrimidine-5-carbonitrile |
| 1,2,3,4-tetrahydro-6-(4-methoxyphenyl)-4-oxo-2-thioxo-5-pyrimidinecarbonitrile |
| 5-cyano-4-methylthiophen-2-ylboronic acid |