2-(2,4-Diaminophenoxy)ethanol sulfate structure
|
Common Name | 2-(2,4-Diaminophenoxy)ethanol sulfate | ||
|---|---|---|---|---|
| CAS Number | 70643-20-8 | Molecular Weight | 266.272 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4-Diaminophenoxy)ethanol sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H14N2O6S |
|---|---|
| Molecular Weight | 266.272 |
| Exact Mass | 266.057251 |
| PSA | 164.48000 |
| LogP | 1.81250 |
| InChIKey | UUHBEKCQQLDQNG-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCCO)c(N)c1.O=S(=O)(O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) |
| 4-(2-Hydroxyethoxy)benzene-1,3-diaminium sulfate |
| EINECS 274-713-2 |
| Ethanol, 2-(2,4-diaminophenoxy)-, sulfate (1:1) (salt) |
| MFCD00035495 |
| 2-(2,4-diaminophenoxy)ethanol,sulfuric acid |