4-[(2,3-Dimethoxyphenyl)carbonothioyl]morpholine structure
|
Common Name | 4-[(2,3-Dimethoxyphenyl)carbonothioyl]morpholine | ||
|---|---|---|---|---|
| CAS Number | 70733-83-4 | Molecular Weight | 267.34400 | |
| Density | 1.207g/cm3 | Boiling Point | 397.3ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | (2,3-dimethoxyphenyl)-morpholin-4-ylmethanethione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760 mmHg |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.34400 |
| Flash Point | 194.1ºC |
| Exact Mass | 267.09300 |
| PSA | 63.02000 |
| LogP | 1.64940 |
| Index of Refraction | 1.581 |
| InChIKey | QIRQJTBIJUUVNB-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=S)N2CCOCC2)c1OC |
|
~%
4-[(2,3-Dimetho... CAS#:70733-83-4 |
| Literature: Farina; Pinza; Gamba; Pifferi European Journal of Medicinal Chemistry, 1979 , vol. 14, # 1 p. 27 - 31 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Morpholine,1-(2,3-dimethoxythiobenzoyl) |
| 4-(2,3-dimethoxy-thiobenzoyl)-morpholine |
| 1-(2,3-Dimethoxythiobenzoyl)morpholine |