3,7-DIMETHYLGALANGIN structure
|
Common Name | 3,7-DIMETHYLGALANGIN | ||
|---|---|---|---|---|
| CAS Number | 70786-48-0 | Molecular Weight | 298.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3,7-DIMETHYLGALANGIN5-Hydroxy-3,7-dimethoxyflavone (compound 1) can be isolated from Kaempferia parviflora, but has no significant toxicity to malaria parasites, fungi, and bacteria[1]. |
| Name | 5-hydroxy-3,7-dimethoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Hydroxy-3,7-dimethoxyflavone (compound 1) can be isolated from Kaempferia parviflora, but has no significant toxicity to malaria parasites, fungi, and bacteria[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Yenjai C, et al. Bioactive flavonoids from Kaempferia parviflora. Fitoterapia. 2004 Jan;75(1):89-92. |
| Molecular Formula | C17H14O5 |
|---|---|
| Molecular Weight | 298.29000 |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.18280 |
| InChIKey | OYCOUDKDRFJOCP-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccccc3)oc2c1 |
| Storage condition | 2-8°C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 4H-1-Benzopyran-4-one,5-hydroxy-3,7-dimethoxy-2-phenyl |
| 3,7-Dimethylgalangin |
| Galangin 3,7-dimethyl ether |
| 3,7-Dimethoxy-5-hydroxyflavone |
| Hydroxy-3,7-Dimethoxyflavone |