Dihydrocitflavanone structure
|
Common Name | Dihydrocitflavanone | ||
|---|---|---|---|---|
| CAS Number | 70897-14-2 | Molecular Weight | 340.370 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 590.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.0±23.6 °C | |
| Name | (2S)-5-Hydroxy-2-(4-hydroxyphenyl)-8,8-dimethyl-2,3,9,10-tetrahyd ro-4H,8H-pyrano[2,3-f]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.370 |
| Flash Point | 215.0±23.6 °C |
| Exact Mass | 340.131073 |
| PSA | 75.99000 |
| LogP | 5.17 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | UJIRULANAUYZIL-INIZCTEOSA-N |
| SMILES | CC1(C)CCc2c(cc(O)c3c2OC(c2ccc(O)cc2)CC3=O)O1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4H,8H-Benzo[1,2-b:3,4-b']dipyran-4-one, 2,3,9,10-tetrahydro-5-hydroxy-2-(4-hydroxyphenyl)-8,8-dimethyl-, (2S)- |
| (2S)-5-Hydroxy-2-(4-hydroxyphenyl)-8,8-dimethyl-2,3,9,10-tetrahydro-4H,8H-pyrano[2,3-f]chromen-4-one |
| Dihydrocitflavanone |