2,4-Dinitroiodobenzene
2,4-Dinitroiodobenzene structure
|
Common Name | 2,4-Dinitroiodobenzene | ||
|---|---|---|---|---|
| CAS Number | 709-49-9 | Molecular Weight | 294.00300 | |
| Density | 2.174 g/cm3 | Boiling Point | 351.8ºC at 760 mmHg | |
| Molecular Formula | C6H3IN2O4 | Melting Point | 86-88 °C(lit.) | |
| MSDS | N/A | Flash Point | 166.6ºC | |
Summary: 2,4-Dinitroiodobenzene (709-49-9) is an organic compound with the molecular formula C6H3IN2O4 and a molecular weight of 294.00300. It is stored at room temperature in a dry environment and is used for antibiotic research. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dinitroiodobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.174 g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760 mmHg |
| Melting Point | 86-88 °C(lit.) |
| Molecular Formula | C6H3IN2O4 |
| Molecular Weight | 294.00300 |
| Flash Point | 166.6ºC |
| Exact Mass | 293.91400 |
| PSA | 91.64000 |
| LogP | 3.15400 |
| Index of Refraction | 1.699 |
| InChIKey | FXMKXMJLXRTQSW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(I)c([N+](=O)[O-])c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R42/43 |
| Safety Phrases | S22-S26-S37 |
| WGK Germany | 3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 211-908-3 |
| MFCD00039738 |
| 2,4-Dinitroiodobenzene |
| 1-iodo-2,4-dinitrobenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,4-dinitroiodobenzene? |
| A: The English name of 2,4-dinitroiodobenzene is 2,4-dinitroiodobenzene. |
| Q: What is the molecular weight of 2,4-dinitroiodobenzene? |
| A: Molecular weight of 2,4-dinitroiodobenzene is 294.00300. |
| Q: What is the boiling point of 2,4-dinitroiodobenzene? |
| A: Boiling point of 2,4-dinitroiodobenzene is 351.8ºC at 760 mmHg. |
| Q: What is the SMILES notation of 2,4-dinitroiodobenzene? |
| A: SMILES notation of 2,4-dinitroiodobenzene is O=[N+]([O-])c1ccc(I)c([N+](=O)[O-])c1. |
| Q: What is the polar surface area (PSA) of 2,4-dinitroiodobenzene? |
| A: Polar surface area (PSA) of 2,4-dinitroiodobenzene is 91.64000. |
| Q: What English synonyms does 2,4-dinitroiodobenzene have? |
| A: English synonyms of 2,4-dinitroiodobenzene: EINECS 211-908-3, MFCD00039738, 2,4-Dinitroiodobenzene, 1-iodo-2,4-dinitrobenzene. |
| Q: What is the LogP of 2,4-dinitroiodobenzene? |
| A: LogP of 2,4-dinitroiodobenzene is 3.15400. |
| Q: What is the melting point of 2,4-dinitroiodobenzene? |
| A: Melting point of 2,4-dinitroiodobenzene is 86-88 °C(lit.). |
| Q: What is the CAS number of 2,4-dinitroiodobenzene? |
| A: CAS number of 2,4-dinitroiodobenzene is 709-49-9. |
| Q: What is the safety information for 2,4-dinitroiodobenzene? |
| A: Safety information for 2,4-dinitroiodobenzene: S22-S26-S37. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |