2,5-dichloro-4-[[5-cyano-2,6-bis[(2-hydroxyethyl)amino]-4-methyl-3-pyridyl]azo]benzenesulphonic acid, compound with 2-(dibutylamino)ethanol (1:1) structure
|
Common Name | 2,5-dichloro-4-[[5-cyano-2,6-bis[(2-hydroxyethyl)amino]-4-methyl-3-pyridyl]azo]benzenesulphonic acid, compound with 2-(dibutylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 70917-04-3 | Molecular Weight | 662.62900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H41Cl2N7O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dibutylamino)ethanol,2,5-dichloro-4-[[5-cyano-2,6-bis(2-hydroxyethylamino)-4-methylpyridin-3-yl]diazenyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H41Cl2N7O6S |
|---|---|
| Molecular Weight | 662.62900 |
| Exact Mass | 661.22200 |
| PSA | 215.37000 |
| LogP | 5.49558 |
| InChIKey | FJXSPXLRXJBNHM-UHFFFAOYSA-N |
| SMILES | CCCCN(CCO)CCCC.Cc1c(C#N)c(NCCO)nc(NCCO)c1N=Nc1cc(Cl)c(S(=O)(=O)O)cc1Cl |
| 2,5-Dichloro-4-((5-cyano-2,6-bis((2-hydroxyethyl)amino)-4-methyl-3-pyridyl)azo)benzenesulphonic acid,compound with 2-(dibutylamino)ethanol (1:1) |
| EINECS 275-023-4 |