9,10-Anthracenedione, 1,4-bis[[4-(dimethylamino)butyl]amino]-5, 8-dihydroxy- structure
|
Common Name | 9,10-Anthracenedione, 1,4-bis[[4-(dimethylamino)butyl]amino]-5, 8-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 70945-67-4 | Molecular Weight | 468.58800 | |
| Density | 1.251g/cm3 | Boiling Point | 698.1ºC at 760 mmHg | |
| Molecular Formula | C26H36N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 376ºC | |
| Name | 1,4-bis[4-(dimethylamino)butylamino]-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 698.1ºC at 760 mmHg |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.58800 |
| Flash Point | 376ºC |
| Exact Mass | 468.27400 |
| PSA | 105.14000 |
| LogP | 3.52660 |
| Index of Refraction | 1.643 |
| InChIKey | LPSUCJBWBVUILJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCCNc1ccc(NCCCCN(C)C)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
|
~%
9,10-Anthracene... CAS#:70945-67-4 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,8-dihydroxy-1,4-bis<4-(dimethylaminobutyl)amino>-9,10-anthracenedione |
| 1,4-Bis((4-(dimethylamino)butyl)amino)-5,8-dihydroxy-9,10-anthracenedione |