9,10-Anthracenedione,2,3-dihydro-1,4,5,8-tetrahydroxy
9,10-Anthracenedione,2,3-dihydro-1,4,5,8-tetrahydroxy structure
|
Common Name | 9,10-Anthracenedione,2,3-dihydro-1,4,5,8-tetrahydroxy | ||
|---|---|---|---|---|
| CAS Number | 81-59-4 | Molecular Weight | 274.22600 | |
| Density | 1.798g/cm3 | Boiling Point | 543.837ºC at 760 mmHg | |
| Molecular Formula | C14H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.768ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.798g/cm3 |
|---|---|
| Boiling Point | 543.837ºC at 760 mmHg |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.22600 |
| Flash Point | 296.768ºC |
| Exact Mass | 274.04800 |
| PSA | 115.06000 |
| LogP | 1.89480 |
| Index of Refraction | 1.796 |
| InChIKey | QJQPINQAQJTYMH-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)c2c1c(O)c1c(O)ccc(O)c1c2O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:3179-90-6
CAS#:19853-97-5
CAS#:19871-57-9
CAS#:65271-80-9![N-[2-[[4-(2-acetamidoethylamino)-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]acetamide structure](https://image.chemsrc.com/caspic/400/70476-97-0.png)
CAS#:70476-97-0![5,8-dihydroxy-1,4-bis[2-(2-hydroxypropylamino)ethylamino]anthracene-9,10-dione structure](https://image.chemsrc.com/caspic/453/70788-93-1.png)
CAS#:70788-93-1![1,4-bis[2-[di(propan-2-yl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione structure](https://image.chemsrc.com/caspic/165/70945-56-1.png)
CAS#:70945-56-1
CAS#:70945-58-3![9,10-Anthracenedione, 1,4-bis[[4-(dimethylamino)butyl]amino]-5, 8-dihydroxy structure](https://image.chemsrc.com/caspic/420/70945-67-4.png)
CAS#:70945-67-4
CAS#:96555-65-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,2,3-dihydro-1,4,5,8-tetrahydroxy |
| EINECS 201-364-5 |
| 2,3-Dihydro-1,4,5,8-tetrahydroxyanthraquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 81-59-4? |
| A: Chinese name of 81-59-4 is 81-59-4. |
| Q: What are the downstream products of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: Related downstream products(CAS) of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione: 3179-90-6;19853-97-5;19871-57-9;65271-80-9;70476-97-0;70788-93-1;70945-56-1;70945-58-3;70945-67-4;96555-65-6. |
| Q: What is the English name of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: The English name of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione. |
| Q: What is the molecular formula of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: Molecular formula of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is C14H10O6. |
| Q: What is the polar surface area (PSA) of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: Polar surface area (PSA) of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is 115.06000. |
| Q: What is the SMILES notation of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: SMILES notation of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is O=C1CCC(=O)c2c1c(O)c1c(O)ccc(O)c1c2O. |
| Q: What is the CAS number of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: CAS number of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is 81-59-4. |
| Q: What is the LogP of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: LogP of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is 1.89480. |
| Q: What is the boiling point of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: Boiling point of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is 543.837ºC at 760 mmHg. |
| Q: What is the molecular weight of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione? |
| A: Molecular weight of 5,8,9,10-tetrahydroxy-2,3-dihydroanthracene-1,4-dione is 274.22600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |