7H-Pyrano[2,3-c]acridin-7-one,3,12-dihydro-6-methoxy-3,3,12-trimethyl-2-nitro structure
|
Common Name | 7H-Pyrano[2,3-c]acridin-7-one,3,12-dihydro-6-methoxy-3,3,12-trimethyl-2-nitro | ||
|---|---|---|---|---|
| CAS Number | 7095-42-3 | Molecular Weight | 366.36700 | |
| Density | 1.39g/cm3 | Boiling Point | 582.9ºC at 760 mmHg | |
| Molecular Formula | C20H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.3ºC | |
| Name | 6-methoxy-3,3,12-trimethyl-2-nitropyrano[2,3-c]acridin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 582.9ºC at 760 mmHg |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.36700 |
| Flash Point | 306.3ºC |
| Exact Mass | 366.12200 |
| PSA | 86.28000 |
| LogP | 4.01210 |
| Index of Refraction | 1.667 |
| InChIKey | FFUMIZNHKKJWAI-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c3c1c(=O)c1ccccc1n3C)C=C([N+](=O)[O-])C(C)(C)O2 |
|
~90%
7H-Pyrano[2,3-c... CAS#:7095-42-3 |
| Literature: Elomri, Abdelhakim; Skaltsounis, Alexios-Leandros; Michel, Sylvie; Tillequin, Francois; Koch, Michel; Rolland, Yves; Pierre, Alain; Atassi, Ghanem Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 11 p. 2165 - 2168 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
| ACRONYCINE,2-NITRO |
| 2-Nitro-acronycine |