Suc-Ala-Ala-Pro-Leu-pNA structure
|
Common Name | Suc-Ala-Ala-Pro-Leu-pNA | ||
|---|---|---|---|---|
| CAS Number | 70968-04-6 | Molecular Weight | 590.62500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38N6O9 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 4-[[1-[[1-[2-[[4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H38N6O9 |
|---|---|
| Molecular Weight | 590.62500 |
| Exact Mass | 590.27000 |
| PSA | 219.83000 |
| LogP | 2.63620 |
| InChIKey | PTHRPHGMGFMCSS-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C1CCCN1C(=O)C(C)NC(=O)C(C)NC(=O)CCC(=O)O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Substrate specificity of human pancreatic elastase 2.
Biochemistry 19 , 468, (1980) The substrate specificity of human pancreatic elastase 2 was investigated by using a series of peptide p-nitroanilides. The kinetic constants, kcat and Km, for the hydrolysis of these peptides reveale... |
| N-Succinyl-Ala-Ala-Pro-Leu p-nitroanilide |
| Suc-Ala-Ala-Pro-Leu-pNA |