2,2,2-TRIFLUORO-1-(2-HYDROXY-5-METHYLPHENYL)-ETHANONE structure
|
Common Name | 2,2,2-TRIFLUORO-1-(2-HYDROXY-5-METHYLPHENYL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 70978-57-3 | Molecular Weight | 204.14600 | |
| Density | 1.342g/cm3 | Boiling Point | 225.5ºC at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | 41ºC | |
| MSDS | N/A | Flash Point | 90.2ºC | |
| Name | 2,2,2-trifluoro-1-(2-hydroxy-5-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 225.5ºC at 760 mmHg |
| Melting Point | 41ºC |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.14600 |
| Flash Point | 90.2ºC |
| Exact Mass | 204.04000 |
| PSA | 37.30000 |
| LogP | 2.44560 |
| Index of Refraction | 1.483 |
| InChIKey | BQXJLIFASBKZNO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C(=O)C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|
|
~35%
2,2,2-TRIFLUORO... CAS#:70978-57-3 |
| Literature: Sevenard, Dmitri V.; Vorobyev, Mikhail; Sosnovskikh, Vyacheslav Ya.; Wessel, Helma; Kazakova, Olesya; Vogel, Vera; Shevchenko, Nikolay E.; Nenajdenko, Valentine G.; Lork, Enno; Roeschenthaler, Gerd-Volker Tetrahedron, 2009 , vol. 65, # 36 p. 7538 - 7552 |
|
~%
2,2,2-TRIFLUORO... CAS#:70978-57-3 |
| Literature: May and Baker Patent: DE2846931 , 1979 ; Chem.Abstr., 1979 , vol. 91, # 74626 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| o-trifluoroacetyl-p-cresol |
| 2,2,2-Trifluoro-1-(2-hydroxy-5-methylphenyl)-ethanone |
| 2-Hydroxy-5-methyltrifluoracetophenon |
| 2-(trifluoroacetyl)-4-methylphenol |
| 2,2,2-trifluoro-1-(2-hydroxy-5-methylphenyl)ethan-1-one |
| 2,2,2-TRICHLORO-1-(1H-INDOL-3-YL)-ETHANONE |
| EINECS 275-078-4 |
| 2,2,2-tris(fluoranyl)-1-(5-methyl-2-oxidanyl-phenyl)ethanone |