levallorphan hydrogen tartrate structure
|
Common Name | levallorphan hydrogen tartrate | ||
|---|---|---|---|---|
| CAS Number | 71-82-9 | Molecular Weight | 283.40800 | |
| Density | N/A | Boiling Point | 660.4ºC at 760 mmHg | |
| Molecular Formula | C19H25NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 353.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | l-Levallorphan tartrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 660.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.40800 |
| Flash Point | 353.2ºC |
| Exact Mass | 283.19400 |
| PSA | 23.47000 |
| LogP | 3.57450 |
| InChIKey | FWMLYVACGDQRFU-ZTMWJVNESA-N |
| SMILES | C=CCN1CCC23CCCCC2C1Cc1ccc(O)cc13.O=C(O)C(O)C(O)C(=O)O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | QD0480000 |
|
The mu opioid irreversible antagonist beta-funaltrexamine differentiates the discriminative stimulus effects of opioids with high and low efficacy at the mu opioid receptor.
Psychopharmacology 140 , 20, (1998) The purpose of the present study was to determine the relative intrinsic efficacy of various opioids using the irreversible mu opioid antagonist beta-funaltrexamine (betaFNA). To this end, pigeons wer... |
|
|
mu-Opioid receptor-stimulated guanosine-5'-O-(gamma-thio)-triphosphate binding in rat thalamus and cultured cell lines: signal transduction mechanisms underlying agonist efficacy.
Mol. Pharmacol. 51 , 87-96, (1997) G protein activation by different mu-selective opioid agonists was examined in rat thalamus, SK-N-SH cells, and mu-opioid receptor-transfected mMOR-CHO cells using agonist-stimulated guanosine-5'-O-(g... |
|
|
Delta opioid modulation of the binding of guanosine-5'-O-(3-[35S]thio)triphosphate to NG108-15 cell membranes: characterization of agonist and inverse agonist effects.
J. Pharmacol. Exp. Ther. 283 , 1276, (1997) The ability of the delta opioid agonist DPDPE ([D-Pen2, D-Pen4]enkephalin) to stimulate binding of the GTP analog guanosine-5'-O-(3-[35S]thio)triphosphate ([35S]GTPgammaS) to pertussis toxin-sensitive... |
|
Name: LOPAC HTS for Inhibitors of Aerobactin Synthetase IucA
Source: 23265
Target: IucA from hypervirulent Klebsiella pneumoniae
External Id: IucA Pilot Assay LOPAC Library
|
| Levallorphan hydrogen tartrate |
| 2H-10,4a-Iminoethanophenanthren-6-ol,11-allyl-1,3,4,9,10,10a-hexahydro-,tartrate |
| Levallorphan tartrate |
| 17-(2-Propenyl)morphinan-3-ol tartrate |
| Levallorphan (+)-tartrate salt |
| Tartrate de levallorphane [French] |
| Morphinan-3-ol,17-allyl-,tartrate (1:1) (salt) |
| EINECS 200-767-3 |