morpholin-4-yl(7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)methanone structure
|
Common Name | morpholin-4-yl(7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 7101-65-7 | Molecular Weight | 310.39000 | |
| Density | 1.205g/cm3 | Boiling Point | 553.3ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.4ºC | |
| Name | morpholin-4-yl(7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 553.3ºC at 760 mmHg |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.39000 |
| Flash Point | 288.4ºC |
| Exact Mass | 310.16800 |
| PSA | 42.43000 |
| LogP | 2.91400 |
| Index of Refraction | 1.621 |
| InChIKey | MVDQLOSFAHIAQA-UHFFFAOYSA-N |
| SMILES | O=C(c1c2c(nc3ccccc13)CCCCC2)N1CCOCC1 |
|
~%
morpholin-4-yl(... CAS#:7101-65-7 |
| Literature: Patnaik,G.K. et al. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 483 - 488 |
|
~%
morpholin-4-yl(... CAS#:7101-65-7 |
| Literature: Patnaik,G.K. et al. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 483 - 488 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carbonyl)-morpholine |
| 6H-Cyclohepta(b)quinoline,7,8,9,10-tetrahydro-11-(morpholinocarbonyl) |
| KETONE,MORPHOLINO(7,8,9,10-TETRAHYDRO-11-(6H-CYCLOHEPTA(b)QUINOLINYL)) |