FOY 251-D4 structure
|
Common Name | FOY 251-D4 | ||
|---|---|---|---|---|
| CAS Number | 71079-09-9 | Molecular Weight | 409.41400 | |
| Density | 1.36g/cm3 | Boiling Point | 592.6ºC at 760 mmHg | |
| Molecular Formula | C17H19N3O7S | Melting Point | 194-198ºC | |
| MSDS | N/A | Flash Point | 312.2ºC | |
Use of FOY 251-D4FOY 251 is an anti-proteolytic active metabolite camostate (HY-13512), acts as a proteinase inhibitor[1]. |
| Name | foy 251 |
|---|---|
| Synonym | More Synonyms |
| Description | FOY 251 is an anti-proteolytic active metabolite camostate (HY-13512), acts as a proteinase inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
proteinase[1] |
| In Vitro | FOY-251 represents a dose-dependent inhibition of equivalent current in M-1 cells[2]. FOY-251 inhibits the proteolytic activity of prostasin[2]. |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 592.6ºC at 760 mmHg |
| Melting Point | 194-198ºC |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.41400 |
| Flash Point | 312.2ºC |
| Exact Mass | 409.09400 |
| PSA | 188.25000 |
| LogP | 3.29610 |
| Index of Refraction | 1.632 |
| InChIKey | JXMOPIDYHUYOED-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.NC(N)=Nc1ccc(C(=O)Oc2ccc(CC(=O)O)cc2)cc1 |
| 4-[[4-[(Aminoiminomethyl)amino]benzoyl]oxy]-benzeneacetic Acid Monomethanesulfonate |
| 4-(4-guanidinobenzoyloxy)phenylacetic acid |
| 4-(4-guanidinobenzoyloxy)phenylacetic acid mesylate |
| 4-[[4-[(Aminoiminomethyl)amino]benzoyl]oxy]-benzeneacetic Acid Monomethanesulfonat |
| p-(p-Guanidinbenzoyloxy)-phenylessigsaeure-methansulfonat |
| p-(p-guanidinobenzoyloxy)phenylacetic acid methanesulphonate |