5H-Benzocyclohepten-5-one,6,7,8,9-tetrahydro-2-methoxy-3-nitro
5H-Benzocyclohepten-5-one,6,7,8,9-tetrahydro-2-methoxy-3-nitro structure
|
Common Name | 5H-Benzocyclohepten-5-one,6,7,8,9-tetrahydro-2-methoxy-3-nitro | ||
|---|---|---|---|---|
| CAS Number | 71089-18-4 | Molecular Weight | 235.23600 | |
| Density | 1.262g/cm3 | Boiling Point | 425.9ºC at 760mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 425.9ºC at 760mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 200.8ºC |
| Exact Mass | 235.08400 |
| PSA | 72.12000 |
| LogP | 3.03570 |
| Index of Refraction | 1.568 |
| InChIKey | OQEMREQQWHVDSF-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C(=O)CCCC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![10-methoxy-11-nitro-bicyclo[5.4.0]undeca-8,10,12-trien-6-one structure](https://image.chemsrc.com/caspic/422/71089-19-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: LogP of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is 3.03570. |
| Q: What is the SMILES notation of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: SMILES notation of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is COc1cc2c(cc1[N+](=O)[O-])C(=O)CCCC2. |
| Q: What are the upstream materials of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: Related upstream materials(CAS) of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one: 6500-65-8;17857-14-6;1226467-43-1;6500-64-7. |
| Q: What is the Chinese name of 71089-18-4? |
| A: Chinese name of 71089-18-4 is 71089-18-4. |
| Q: What is the English name of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: The English name of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one. |
| Q: What is the CAS number of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: CAS number of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is 71089-18-4. |
| Q: What is the InChIKey of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: InChIKey of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is OQEMREQQWHVDSF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: Molecular formula of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is C12H13NO4. |
| Q: What is the polar surface area (PSA) of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: Polar surface area (PSA) of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is 72.12000. |
| Q: What is the molecular weight of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one? |
| A: Molecular weight of 2-methoxy-3-nitro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is 235.23600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |