(3-Carboxypropyl)(triphenyl)phosphonium bromide structure
|
Common Name | (3-Carboxypropyl)(triphenyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 17857-14-6 | Molecular Weight | 429.287 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22BrO2P | Melting Point | 244-247 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-carboxypropyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 244-247 °C(lit.) |
|---|---|
| Molecular Formula | C22H22BrO2P |
| Molecular Weight | 429.287 |
| Exact Mass | 428.054077 |
| PSA | 50.89000 |
| LogP | 0.84930 |
| InChIKey | NKVJKVMGJABKHV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
|
Mitochondrial delivery of doxorubicin via triphenylphosphine modification for overcoming drug resistance in MDA-MB-435/DOX cells.
Mol. Pharm. 11(8) , 2640-9, (2014) In this study, doxorubicin (DOX) was conjugated to a lipophilic triphenylphosphonium (TPP) that is selectively taken up by the mitochondrial membrane of cells. This new derivative of DOX, i.e., TPP-DO... |
| (3-Carboxypropyl)triphenylphosphonium bromide |
| (3-Carboxypropyl)(triphenyl)phosphonium bromide |
| Ph3PCH2CH2CH2COOH bromide |
| Phosphonium, (3-carboxypropyl)triphenyl-, bromide (1:1) |
| (4-Hydroxy-4-oxobutyl)triphenylphosphonium bromide |
| MFCD00274196 |
| 3-Carboxypropyl triphenylphosphonium bromide |