Ethanone,2,2,2-trifluoro-1-(4-methoxyphenyl)- structure
|
Common Name | Ethanone,2,2,2-trifluoro-1-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 711-38-6 | Molecular Weight | 204.14600 | |
| Density | 1.32 | Boiling Point | 64°C/0.5mm | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.6ºC | |
| Name | 4-Methoxy-2,2,2-Trifluoroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 |
|---|---|
| Boiling Point | 64°C/0.5mm |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.14600 |
| Flash Point | 94.6ºC |
| Exact Mass | 204.04000 |
| PSA | 26.30000 |
| LogP | 2.44020 |
| Index of Refraction | 1.45 |
| InChIKey | NCJZVRPXSSYDBG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(F)(F)F)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2,2-trifluoro-1-(4-methoxyphenyl)ethanone |
| MFCD00018061 |