1,2,3,4,5-pentafluoro-6-prop-1-en-2-yl-benzene structure
|
Common Name | 1,2,3,4,5-pentafluoro-6-prop-1-en-2-yl-benzene | ||
|---|---|---|---|---|
| CAS Number | 711-44-4 | Molecular Weight | 208.12800 | |
| Density | 1.331g/cm3 | Boiling Point | 144.5ºC at 760 mmHg | |
| Molecular Formula | C9H5F5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 43.6ºC | |
| Name | 1,2,3,4,5-pentafluoro-6-prop-1-en-2-ylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 144.5ºC at 760 mmHg |
| Molecular Formula | C9H5F5 |
| Molecular Weight | 208.12800 |
| Flash Point | 43.6ºC |
| Exact Mass | 208.03100 |
| LogP | 3.41520 |
| Index of Refraction | 1.43 |
| InChIKey | UEVFYGLYGZACQJ-UHFFFAOYSA-N |
| SMILES | C=C(C)c1c(F)c(F)c(F)c(F)c1F |
|
~%
1,2,3,4,5-penta... CAS#:711-44-4 |
| Literature: Barbour,A.K. et al. Journal of the Chemical Society, 1961 , p. 808 - 817 |
|
~%
1,2,3,4,5-penta... CAS#:711-44-4 |
| Literature: Barbour,A.K. et al. Journal of the Chemical Society, 1961 , p. 808 - 817 |
| 2-(Pentafluorphenyl)-propen |
| 1,2,3,4,5-pentafluoro-6-(prop-1-en-2-yl)benzene |
| pentafluoro(1-methylethenyl)-benzene |
| 1-methyl-2',3',4',5',6'-pentafluorostyrene |
| 2-Pentafluorphenyl-prop-1-en |