S-(4-formyl-2-methoxyphenyl) N,N-dimethylcarbamothioate structure
|
Common Name | S-(4-formyl-2-methoxyphenyl) N,N-dimethylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 71125-95-6 | Molecular Weight | 239.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(4-formyl-2-methoxyphenyl) N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3S |
|---|---|
| Molecular Weight | 239.29100 |
| Exact Mass | 239.06200 |
| PSA | 71.91000 |
| LogP | 2.28140 |
| InChIKey | HOPUGRGNRXYOQD-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)ccc1SC(=O)N(C)C |
|
~80%
S-(4-formyl-2-m... CAS#:71125-95-6 |
| Literature: Wong; Sasso; Jones; Kaminski Journal of Medicinal Chemistry, 1984 , vol. 27, # 1 p. 20 - 27 |
|
~%
S-(4-formyl-2-m... CAS#:71125-95-6 |
| Literature: Wong; Sasso; Jones; Kaminski Journal of Medicinal Chemistry, 1984 , vol. 27, # 1 p. 20 - 27 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Carbamothioic acid,dimethyl-,S-(4-formyl-2-methoxyphenyl) ester |
| 4-dimethylcarbamoylsulfanyl-3-methoxybenzaldehyde |
| 4-(N,N-dimethylcarbamoylthio)-3-methoxybenzaldehyde |
| 3-methoxy-4-[(dimethylcarbamoyl)thio]benzaldehyde |