Methyl 2-phenyl-1,3-thiazole-4-carboxylate structure
|
Common Name | Methyl 2-phenyl-1,3-thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7113-02-2 | Molecular Weight | 219.260 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 353.1±34.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO2S | Melting Point | 77-78ºC | |
| MSDS | N/A | Flash Point | 167.4±25.7 °C | |
| Name | methyl 2-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.1±34.0 °C at 760 mmHg |
| Melting Point | 77-78ºC |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.260 |
| Flash Point | 167.4±25.7 °C |
| Exact Mass | 219.035400 |
| PSA | 67.43000 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | VGWOUTBYGICCLO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1csc(-c2ccccc2)n1 |
| HS Code | 2934100090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-phenyl-1,3-thiazole-4-carboxylic acid methyl ester |
| 2-Phenyl-thiazol-4-carbonsaeure-methylester |
| 2-Phenylthiazole-4-carboxylic Acid Methyl Ester |
| METHYL 2-PHENYLTHIAZOLE-4-CARBOXYLATE |
| Methyl 2-phenyl-1,3-thiazole-4-carboxylate |
| 4-Thiazolecarboxylic acid, 2-phenyl-, methyl ester |