Acetamide, N-ethyl-N-(p-tolyl)- structure
|
Common Name | Acetamide, N-ethyl-N-(p-tolyl)- | ||
|---|---|---|---|---|
| CAS Number | 71173-13-2 | Molecular Weight | 241.30700 | |
| Density | 1.238g/cm3 | Boiling Point | 376.2ºC at 760 mmHg | |
| Molecular Formula | C11H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | N-ethylsulfonyl-N-(4-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760 mmHg |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.30700 |
| Flash Point | 181.3ºC |
| Exact Mass | 241.07700 |
| PSA | 62.83000 |
| LogP | 2.77840 |
| Index of Refraction | 1.556 |
| InChIKey | IUTIXSIPOCWLIJ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N(C(C)=O)c1ccc(C)cc1 |
|
~%
Acetamide, N-et... CAS#:71173-13-2 |
| Literature: Ueda,Y. et al. Chemical and Pharmaceutical Bulletin, 1964 , vol. 12, p. 5 - 13 |
|
~%
Acetamide, N-et... CAS#:71173-13-2 |
| Literature: Monsanto Chem. Co. Patent: US1916604 , 1929 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Acetyl-N-aethyl-p-toluolsulfonamid |
| Acetamide,N-ethyl-N-(p-tolylsulfonyl) |
| acetyl-ethyl-(toluene-4-sulfonyl)-amine |
| Acetyl-aethyl-(toluol-4-sulfonyl)-amin |
| N-ethyl-N-p-toluenesulfonylacetamide |
| Acetamide,N-ethyl-N-(p-tolyl) |