2-CHLORO-1,2-DI-P-TOLYL-ETHANONE structure
|
Common Name | 2-CHLORO-1,2-DI-P-TOLYL-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 71193-32-3 | Molecular Weight | 258.74300 | |
| Density | 1.143g/cm3 | Boiling Point | 383.8ºC at 760 mmHg | |
| Molecular Formula | C16H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.6ºC | |
| Name | 2-chloro-1,2-bis(4-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 383.8ºC at 760 mmHg |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.74300 |
| Flash Point | 223.6ºC |
| Exact Mass | 258.08100 |
| PSA | 17.07000 |
| LogP | 4.46620 |
| Index of Refraction | 1.579 |
| InChIKey | NNLSZLIKQWMSNT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(Cl)c2ccc(C)cc2)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
2-CHLORO-1,2-DI... CAS#:71193-32-3 |
| Literature: Popielarz; Arnold Journal of the American Chemical Society, 1990 , vol. 112, # 8 p. 3068 - 3082 |
|
~%
2-CHLORO-1,2-DI... CAS#:71193-32-3 |
| Literature: Bak,C.; Praefcke,K. Chemische Berichte, 1979 , vol. 112, p. 2744 - 2749 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-1,2-di-p-tolylethanone |
| 1,2-bis-p-tolyl-2-chloroethanone |
| 2-Chlor-1,2-bis(4-methylphenyl)ethanon |