Pentafluorophenyl Acrylate structure
|
Common Name | Pentafluorophenyl Acrylate | ||
|---|---|---|---|---|
| CAS Number | 71195-85-2 | Molecular Weight | 238.11100 | |
| Density | 1.49g/cm3 | Boiling Point | 145-149ºC | |
| Molecular Formula | C9H3F5O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 88.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2,3,4,5,6-pentafluorophenyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 145-149ºC |
| Molecular Formula | C9H3F5O2 |
| Molecular Weight | 238.11100 |
| Flash Point | 88.6ºC |
| Exact Mass | 238.00500 |
| PSA | 26.30000 |
| LogP | 2.47350 |
| Index of Refraction | 1.437 |
| InChIKey | RFOWDPMCXHVGET-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
|
~87%
Pentafluorophen... CAS#:71195-85-2 |
| Literature: Blazejewski, Jean-Claude; Hofstraat, Johannes W.; Lequesne, Christelle; Wakselman, Claude; Wiersum, Ulfert E. Journal of Fluorine Chemistry, 1999 , vol. 97, # 1-2 p. 191 - 199 |
|
~86%
Pentafluorophen... CAS#:71195-85-2 |
| Literature: Akzo Nobel N.V. Patent: EP824096 A2, 1998 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Reactive thiol-ene emulsion-templated porous polymers incorporating pentafluorophenyl acrylate Kircher L, et al.
Polymer 54(7) , 1755-1761, (2013)
|
|
|
Factors influencing the synthesis and the post-modification of PEGylated pentafluorophenyl acrylate containing copolymers Beija M, et al.
Eur. Polym. J. 49 , 3060–3071, (2013)
|
| Pentafluorophenyl prop-2-enoate |
| Perfluorophenyl acrylate |
| pentafluorophenyl acrylate |
| PC4610 |