Benzenesulfonic acid,4-amino-2-nitro structure
|
Common Name | Benzenesulfonic acid,4-amino-2-nitro | ||
|---|---|---|---|---|
| CAS Number | 712-24-3 | Molecular Weight | 218.18700 | |
| Density | 1.727 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Nitroaniline-4-sulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.727 g/cm3 |
|---|---|
| Molecular Formula | C6H6N2O5S |
| Molecular Weight | 218.18700 |
| Exact Mass | 218.00000 |
| PSA | 134.59000 |
| LogP | 2.60890 |
| Index of Refraction | 1.662 |
| InChIKey | ZNMGCJDUZADKPW-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 211-920-9 |
| 4-amino-2-nitrobenzenesulfonic acid |
| MFCD00059185 |