Schizandriside structure
|
Common Name | Schizandriside | ||
|---|---|---|---|---|
| CAS Number | 71222-06-5 | Molecular Weight | 492.52 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 729.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C25H32O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.8±32.9 °C | |
Use of SchizandrisideSchizandriside is a cerebroside, which can be isolated from Uvaria tonkinensis var.[1]. |
| Name | [(1S,2R,3R)-7-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydro-2-naphthalenyl]methyl β-D-xylopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Schizandriside is a cerebroside, which can be isolated from Uvaria tonkinensis var.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 729.2±60.0 °C at 760 mmHg |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 |
| Flash Point | 394.8±32.9 °C |
| Exact Mass | 492.199554 |
| LogP | 0.76 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | TXSJJCSJHIDTDE-JTVAWUQMSA-N |
| SMILES | COc1cc(C2c3cc(O)c(OC)cc3CC(CO)C2COC2OCC(O)C(O)C2O)ccc1O |
| Hazard Codes | Xi |
|---|
| β-D-Xylopyranoside, [(1S,2R,3R)-1,2,3,4-tetrahydro-7-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-6-methoxy-2-naphthalenyl]methyl |
| [(1S,2R,3R)-7-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydro-2-naphthalenyl]methyl β-D-xylopyranoside |