p-hydroxybenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | p-hydroxybenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71331-90-3 | Molecular Weight | 287.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,4-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H21NO6 |
|---|---|
| Molecular Weight | 287.30900 |
| Exact Mass | 287.13700 |
| PSA | 121.46000 |
| InChIKey | RHHNHEPENUSNDO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(O)cc1.OCCN(CCO)CCO |
|
~%
p-hydroxybenzoi... CAS#:71331-90-3 |
| Literature: JORDAN, Roy, Arlington Patent: WO2008/155520 A2, 2008 ; Location in patent: Page/Page column 11-12 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 275-334-5 |
| triethanolammonium 4-hydroxybenzoate |
| p-Hydroxybenzoic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |