Dimethyl(pentafluorophenyl)silyloxyethane structure
|
Common Name | Dimethyl(pentafluorophenyl)silyloxyethane | ||
|---|---|---|---|---|
| CAS Number | 71338-73-3 | Molecular Weight | 270.271 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 234.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H11F5OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.4±27.3 °C | |
| Name | Dimethylethoxysilylpentafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 234.2±40.0 °C at 760 mmHg |
| Molecular Formula | C10H11F5OSi |
| Molecular Weight | 270.271 |
| Flash Point | 95.4±27.3 °C |
| Exact Mass | 270.049927 |
| PSA | 9.23000 |
| LogP | 4.09 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | HOENFMGYUBYVDH-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | F: Flammable; |
|---|---|
| HS Code | 2931900090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| fluoro-(fluoromethyl)-(2-phenylethoxy)-(trifluoromethyl)silane |
| Dimethyl(pentafluorophenyl)silyloxyethane |
| Benzene, 1-(ethoxydimethylsilyl)-2,3,4,5,6-pentafluoro- |
| Ethoxy(dimethyl)(pentafluorophenyl)silane |
| Dimethyl(2,3,4,5,6-pentafluorophenyl)silyl ethyl ether |
| MFCD00191684 |