2,2-diphenylethanesulfonyl chloride
Modify Date: 2025-09-27 21:08:59
2,2-diphenylethanesulfonyl chloride structure
|
Common Name | 2,2-diphenylethanesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 71351-01-4 | Molecular Weight | 280.77000 | |
| Density | 1.284g/cm3 | Boiling Point | 383.7ºC at 760 mmHg | |
| Molecular Formula | C14H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | 2,2-diphenylethanesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 383.7ºC at 760 mmHg |
| Molecular Formula | C14H13ClO2S |
| Molecular Weight | 280.77000 |
| Flash Point | 185.9ºC |
| Exact Mass | 280.03200 |
| PSA | 42.52000 |
| LogP | 4.46790 |
| Index of Refraction | 1.596 |
| InChIKey | DYESDWUOAPVIIV-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CC(c1ccccc1)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|
|
~%
2,2-diphenyleth... CAS#:71351-01-4 |
| Literature: Fong,H.O. et al. Canadian Journal of Chemistry, 1979 , vol. 57, p. 1206 - 1213 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2-diphenylethanesulfonylchloride |
| AR3521 |
| 2,2-DIMETHYL-5-(4-METHYLBENZYL)-1,3-DIOXANE-4,6-DIONE |
| Benzhydrylmethylsulphonyl chloride |
| DES-0-0 |