AIM structure
|
Common Name | AIM | ||
|---|---|---|---|---|
| CAS Number | 71422-67-8 | Molecular Weight | 540.655 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H9Cl3F5N3O3 | Melting Point | 232-233.5ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | chlorfluazuron |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 232-233.5ºC |
| Molecular Formula | C20H9Cl3F5N3O3 |
| Molecular Weight | 540.655 |
| Exact Mass | 538.962952 |
| PSA | 80.32000 |
| LogP | 5.97 |
| Index of Refraction | 1.597 |
| InChIKey | UISUNVFOGSJSKD-UHFFFAOYSA-N |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(Oc2ncc(C(F)(F)F)cc2Cl)c(Cl)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | N |
| RIDADR | 3077 |
| RTECS | CV3459580 |
| Packaging Group | III |
| Hazard Class | 9 |
|
Bait matrix for delivery of chitin synthesis inhibitors to the formosan subterranean termite (Isoptera: Rhinotermitidae).
J. Econ. Entomol. 94(2) , 506-10, (2001) The efficacy of three chitin synthesis inhibitors, diflubenzuron, hexaflumuron, and chlorfluazuron, incorporated into a novel bait matrix to kill the Formosan subterranean termite, Coptotermes formosa... |
|
|
Areawide field study on effect of three chitin synthesis inhibitor baits on populations of Coptotermes formosanus and Reticulitermes flavipes (Isoptera: Rhinotermitidae).
J. Econ. Entomol. 104(3) , 1009-17, (2011) Periodic sampling of 43 independent monitors, initially active with Formosan subterranean termite, Coptotermes formosanus Shiraki, or the eastern subterranean termite, Reticulitermes flavipes (Kollar)... |
|
|
Effects of various insecticides on the development of the egg parasitoid Trichogramma dendrolimi (Hymenoptera: Trichogrammatidae).
J. Econ. Entomol. 94(6) , 1340-3, (2001) The toxicity of six insecticides, acephate, methomyl, ethofenprox, cartap, chlorfluazuron, and Bacillus thuringiensis (Bt) was tested on different developmental stages of the egg parasitoid, Trichogra... |
| N-[(3,5-Dichloro-4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenyl)carbamoyl]-2,6-difluorobenzamide |
| Atabron 5E |
| ATABRON |
| N-[[[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]amino]carbonyl]-2,6-difluorobenzamide |
| AIM |
| HELIX |
| Benzamide, N-[[[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]amino]carbonyl]-2,6-difluoro- |
| iki7899 |
| pp145 |
| MFCD00143948 |
| N-[(3,5-Dichlor-4-{[3-chlor-5-(trifluormethyl)pyridin-2-yl]oxy}phenyl)carbamoyl]-2,6-difluorbenzamid |
| N-[(3,5-Dichloro-4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenyl)carbamoyl]-2,6-difluorobenzamide |
| 1-[3,5-dichloro-4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenyl]-3-(2,6-difluorobenzoyl)urea |
| Chlorfluazuron |
| JUPITER |