1,2-bis(2,3-dimethoxyphenyl)ethanamine structure
|
Common Name | 1,2-bis(2,3-dimethoxyphenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 7148-04-1 | Molecular Weight | 317.38000 | |
| Density | 1.119g/cm3 | Boiling Point | 425.7ºC at 760 mmHg | |
| Molecular Formula | C18H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | 1,2-bis(2,3-dimethoxyphenyl)ethanamine |
|---|
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 425.7ºC at 760 mmHg |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38000 |
| Flash Point | 212.1ºC |
| Exact Mass | 317.16300 |
| PSA | 62.94000 |
| LogP | 3.66380 |
| Index of Refraction | 1.551 |
| InChIKey | AIEJFYBNOQOFPN-UHFFFAOYSA-N |
| SMILES | COc1cccc(CC(N)c2cccc(OC)c2OC)c1OC |
|
~%
1,2-bis(2,3-dim... CAS#:7148-04-1 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
|
~%
1,2-bis(2,3-dim... CAS#:7148-04-1 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
|
~%
1,2-bis(2,3-dim... CAS#:7148-04-1 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
|
~%
1,2-bis(2,3-dim... CAS#:7148-04-1 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |