L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl ester
L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl ester structure
|
Common Name | L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7148-24-5 | Molecular Weight | 352.33900 | |
| Density | 1.253g/cm3 | Boiling Point | 536.2ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O7 | Melting Point | 92-94ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 278.1ºC | |
Use of L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl esterN-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester is a glutamic acid derivative[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | N-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 536.2ºC at 760 mmHg |
| Melting Point | 92-94ºC(lit.) |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.33900 |
| Flash Point | 278.1ºC |
| Exact Mass | 352.12700 |
| PSA | 127.52000 |
| LogP | 2.51370 |
| Index of Refraction | 1.531 |
| InChIKey | OTQQWHKIMACEHP-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OCC |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Safety Phrases | S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:4271-30-1
CAS#:6141-27-1
CAS#:6758-40-3
CAS#:31137-74-3
CAS#:13726-52-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-Nitrobenzoyl)-L-glutamic acid diethylester |
| N-(P-NITROBENZOYL)-L-GLUTAMIC ACID DIETHYL ESTER |
| MFCD00007347 |
| DIETHYL N-(4-NITROBENZOYL)-L-GLUTAMATE |
| EINECS 230-464-1 |
| N-(4-Nitro-benzoyl)-L-glutaminsaeure-diaethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Molecular formula of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is C16H20N2O7. |
| Q: What is the InChIKey of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: InChIKey of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is OTQQWHKIMACEHP-ZDUSSCGKSA-N. |
| Q: What are the downstream products of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Related downstream products(CAS) of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester: 4271-30-1;6141-27-1;6758-40-3;31137-74-3;13726-52-8. |
| Q: What is the safety information for n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Safety information for n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester: S24/25. |
| Q: What is the melting point of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Melting point of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is 92-94ºC(lit.). |
| Q: What are the uses of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Main uses of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester: N-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester is a glutamic acid derivative[1]. |
| Q: What is the boiling point of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Boiling point of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is 536.2ºC at 760 mmHg. |
| Q: What is the molecular weight of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Molecular weight of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is 352.33900. |
| Q: What is the polar surface area (PSA) of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: Polar surface area (PSA) of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is 127.52000. |
| Q: What is the English name of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester? |
| A: The English name of n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester is n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |