L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl ester structure
|
Common Name | L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7148-24-5 | Molecular Weight | 352.33900 | |
| Density | 1.253g/cm3 | Boiling Point | 536.2ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O7 | Melting Point | 92-94ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 278.1ºC | |
Use of L-Glutamic acid,N-(4-nitrobenzoyl)-, 1,5-diethyl esterN-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester is a glutamic acid derivative[1]. |
| Name | n-(4-nitrobenzoyl)-l-glutamic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | N-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 536.2ºC at 760 mmHg |
| Melting Point | 92-94ºC(lit.) |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.33900 |
| Flash Point | 278.1ºC |
| Exact Mass | 352.12700 |
| PSA | 127.52000 |
| LogP | 2.51370 |
| Index of Refraction | 1.531 |
| InChIKey | OTQQWHKIMACEHP-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OCC |
| Safety Phrases | S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| N-(4-Nitrobenzoyl)-L-glutamic acid diethylester |
| N-(P-NITROBENZOYL)-L-GLUTAMIC ACID DIETHYL ESTER |
| MFCD00007347 |
| DIETHYL N-(4-NITROBENZOYL)-L-GLUTAMATE |
| EINECS 230-464-1 |
| N-(4-Nitro-benzoyl)-L-glutaminsaeure-diaethylester |