5-methyl-4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methyl]-2-phenyl-4H-pyrazol-3-one structure
|
Common Name | 5-methyl-4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methyl]-2-phenyl-4H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 7149-40-8 | Molecular Weight | 360.40900 | |
| Density | 1.28g/cm3 | Boiling Point | 592.6ºC at 760 mmHg | |
| Molecular Formula | C21H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.2ºC | |
| Name | 4,4'-Methylenbis(2-methyl-1-naphthol) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 592.6ºC at 760 mmHg |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.40900 |
| Flash Point | 312.2ºC |
| Exact Mass | 360.15900 |
| PSA | 65.34000 |
| LogP | 2.45550 |
| Index of Refraction | 1.668 |
| InChIKey | GSGQPWUAVWEUIW-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1CC1C(=O)N(c2ccccc2)N=C1C |
|
~92%
5-methyl-4-[(3-... CAS#:7149-40-8 |
| Literature: Degtev; Morozova; Smirnov Russian Journal of General Chemistry, 1998 , vol. 68, # 5 p. 704 - 709 |
|
~66%
5-methyl-4-[(3-... CAS#:7149-40-8 |
| Literature: Elnagdi, Mohamed Hilmy; Ghozlan, Said Ahmed Soliman; Abdelrazek, Fathy Mohamed; Selim, Maghraby Ali Journal of Chemical Research, Miniprint, 1991 , # 5 p. 1021 - 1032 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 5,5'-dimethyl-2,2'-diphenyl-1,2,1',2'-tetrahydro-4,4'-methanediyl-bis-pyrazol-3-one |
| 1-Naphthalenol,4,4'-methylenebis[2-methyl |
| 4,4'-methylene-bis(1-phenyl-3-methyl-2-pyrazolin-5-one) |
| 4,4'-bis(2-methyl-1-hydroxynaphthyl)methane |
| 4,4'-Methylenbis(5-methyl-2-phenyl-2H,4H-pyrazol-3-on) |