2-[(3-nitrophenyl)methyl]propanedioic acid structure
|
Common Name | 2-[(3-nitrophenyl)methyl]propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 7151-20-4 | Molecular Weight | 239.18200 | |
| Density | 1.526g/cm3 | Boiling Point | 480.1ºC at 760 mmHg | |
| Molecular Formula | C10H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
| Name | 2-[(3-nitrophenyl)methyl]propanedioic acid |
|---|
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 480.1ºC at 760 mmHg |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.18200 |
| Flash Point | 210ºC |
| Exact Mass | 239.04300 |
| PSA | 120.42000 |
| LogP | 1.44590 |
| Index of Refraction | 1.615 |
| InChIKey | FGLDMXBKDAHVHZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1cccc([N+](=O)[O-])c1)C(=O)O |
|
~%
2-[(3-nitrophen... CAS#:7151-20-4 |
| Literature: Gulland et al. Journal of the Chemical Society, 1929 , p. 1674 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |