4-(Methanesulfonylamino)benzoic acid structure
|
Common Name | 4-(Methanesulfonylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7151-76-0 | Molecular Weight | 215.22600 | |
| Density | 1.51g/cm3 | Boiling Point | 408.8ºC at 760 mmHg | |
| Molecular Formula | C8H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201ºC | |
| Name | 4-(Methylsulfonamido)benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 408.8ºC at 760 mmHg |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.22600 |
| Flash Point | 201ºC |
| Exact Mass | 215.02500 |
| PSA | 91.85000 |
| LogP | 1.91010 |
| Index of Refraction | 1.621 |
| InChIKey | SROHFTOYGFCJAF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)O)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2935009090 |
|
~72%
4-(Methanesulfo... CAS#:7151-76-0 |
| Literature: Journal of Organic Chemistry, , vol. 66, # 25 p. 8293 - 8296 |
|
~%
4-(Methanesulfo... CAS#:7151-76-0 |
| Literature: US2002/58809 A1, ; |
|
~94%
4-(Methanesulfo... CAS#:7151-76-0 |
| Literature: Tetrahedron Letters, , vol. 49, # 44 p. 6300 - 6303 |
|
~90%
4-(Methanesulfo... CAS#:7151-76-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 5, # 9 p. 1873 - 1882 |
|
~63%
4-(Methanesulfo... CAS#:7151-76-0 |
| Literature: US5602277 A1, ; |
|
~%
4-(Methanesulfo... CAS#:7151-76-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 5, # 9 p. 1873 - 1882 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-(methanesulfonamido)benzoic acid |