1,3-bis[(4-dimethylaminophenyl)methylideneamino]thiourea structure
|
Common Name | 1,3-bis[(4-dimethylaminophenyl)methylideneamino]thiourea | ||
|---|---|---|---|---|
| CAS Number | 7155-10-4 | Molecular Weight | 368.49900 | |
| Density | 1.127g/cm3 | Boiling Point | 530.355ºC at 760 mmHg | |
| Molecular Formula | C19H24N6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.549ºC | |
| Name | 1,3-bis[[4-(dimethylamino)phenyl]methylideneamino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 530.355ºC at 760 mmHg |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.49900 |
| Flash Point | 274.549ºC |
| Exact Mass | 368.17800 |
| PSA | 87.35000 |
| LogP | 3.43250 |
| Index of Refraction | 1.599 |
| InChIKey | MBUQGKAMDXBKEA-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=NNC(=S)NN=Cc2ccc(N(C)C)cc2)cc1 |
|
~96%
1,3-bis[(4-dime... CAS#:7155-10-4 |
| Literature: Rajendran, G.; Jain, Sampat R. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 680 - 682 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis-(4-dimethylamino-benzyliden)-thiocarbonohydrazid |
| bis-(4-dimethylamino-benzylidene)-thio carbonohydrazide |
| 1,5-bis(4-N,N-dimethylaminobenzylidene)thiocarbonohydrazide |
| 1,3-bis[(4-dimethylaminophenyl)methylideneamino]thiourea |
| (4-DIMETHYLAMINOPHENYL)METHYLIDENEAMINOAMINO-[(4-DIMETHYLAMINOPHENYL)METHYLIDENEAMINOIMINO]METHANETHIOL |