3α,6β-Ditigloyloxytropan-7β-ol
3α,6β-Ditigloyloxytropan-7β-ol structure
|
Common Name | 3α,6β-Ditigloyloxytropan-7β-ol | ||
|---|---|---|---|---|
| CAS Number | 7159-86-6 | Molecular Weight | 337.411 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 435.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.2±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.6±45.0 °C at 760 mmHg |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.411 |
| Flash Point | 217.2±28.7 °C |
| Exact Mass | 337.188934 |
| PSA | 76.07000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | FRQMNJFBOJQRAQ-KCRLEBACSA-N |
| SMILES | CC=C(C)C(=O)OC1CC2C(O)C(OC(=O)C(C)=CC)C(C1)N2C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (1S,3S,5R,6R,7S)-7-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)bis(2-methyl-2-butenoate) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: LogP of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is 3.26. |
| Q: What is the CAS number of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: CAS number of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is 7159-86-6. |
| Q: What is the polar surface area (PSA) of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: Polar surface area (PSA) of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is 76.07000. |
| Q: What is the boiling point of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: Boiling point of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is 435.6±45.0 °C at 760 mmHg. |
| Q: What is the molecular formula of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: Molecular formula of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is C18H27NO5. |
| Q: What is the SMILES notation of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: SMILES notation of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is CC=C(C)C(=O)OC1CC2C(O)C(OC(=O)C(C)=CC)C(C1)N2C. |
| Q: What is the InChIKey of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: InChIKey of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is FRQMNJFBOJQRAQ-KCRLEBACSA-N. |
| Q: What English synonyms does (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) have? |
| A: English synonyms of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate): (1S,3S,5R,6R,7S)-7-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)bis(2-methyl-2-butenoate). |
| Q: What is the English name of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: The English name of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate). |
| Q: What is the molecular weight of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate)? |
| A: Molecular weight of (1S,3S,5R,6R,7S)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl (2E,2'E)-bis(2-methylbut-2-enoate) is 337.411. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |