dimethyl 6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-2,3-dicarboxylate,chloride structure
|
Common Name | dimethyl 6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-2,3-dicarboxylate,chloride | ||
|---|---|---|---|---|
| CAS Number | 71622-22-5 | Molecular Weight | 377.77600 | |
| Density | 1.42g/cm3 | Boiling Point | 479.4ºC at 760 mmHg | |
| Molecular Formula | C18H16ClNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | dimethyl 6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-2,3-dicarboxylate,chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 479.4ºC at 760 mmHg |
| Molecular Formula | C18H16ClNO6 |
| Molecular Weight | 377.77600 |
| Flash Point | 243.7ºC |
| Exact Mass | 377.06700 |
| PSA | 74.94000 |
| Index of Refraction | 1.638 |
| InChIKey | HAUSZGYPCXDNCF-UHFFFAOYSA-M |
| SMILES | COC(=O)c1cc2[n+](cc1C(=O)OC)CCc1cc3c(cc1-2)OCO3.[Cl-] |
|
~%
dimethyl 6,7-di... CAS#:71622-22-5 |
| Literature: Chinnasamy,P.; Shamma,M. Canadian Journal of Chemistry, 1979 , vol. 57, p. 1647 - 1651 |
|
~%
dimethyl 6,7-di... CAS#:71622-22-5 |
| Literature: Chinnasamy,P.; Shamma,M. Canadian Journal of Chemistry, 1979 , vol. 57, p. 1647 - 1651 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3-bis-methoxycarbonyl-6,7-dihydro-[1,3]dioxolo[4,5-g]pyrido[2,1-a]isoquinolinylium,chloride |
| berberidic acid dimethyl ester,chloride |
| Berberidinsaeure-dimethylester |