4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid structure
|
Common Name | 4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 71675-87-1 | Molecular Weight | 259.279 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 529.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C10H13NO5S | Melting Point | 82-85ºC | |
| MSDS | N/A | Flash Point | 274.1±30.1 °C | |
| Name | 4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.6±50.0 °C at 760 mmHg |
| Melting Point | 82-85ºC |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.279 |
| Flash Point | 274.1±30.1 °C |
| Exact Mass | 259.051453 |
| PSA | 115.07000 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1cc(C(=O)O)c(OC)cc1N |
| Storage condition | -20°C Freezer |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2930909090 |
|
~82%
4-Amino-5-(ethy... CAS#:71675-87-1 |
| Literature: LUPIN LIMITED; PAGHDAR, Dinesh, Jayntibhai; KOLEKAR, Mahesh, Ramkumar; DESHPANDE, Tushar, Nandkumar; PATIL, Suryaprakash, Pandurang; CHAVAN, Yuvraj, Atmaram; RAY, Purna, Chandra; SINGH, Girij, Pal Patent: WO2011/158084 A1, 2011 ; Location in patent: Page/Page column 12 ; |
|
~%
4-Amino-5-(ethy... CAS#:71675-87-1 |
| Literature: WO2011/158084 A1, ; |
|
~%
4-Amino-5-(ethy... CAS#:71675-87-1 |
| Literature: WO2011/158084 A1, ; |
|
~%
4-Amino-5-(ethy... CAS#:71675-87-1 |
| Literature: WO2011/158084 A1, ; |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid |
| 4-amino-5-(ethylsulfonyl)-2-methoxy-Benzoic acid |
| EINECS 275-833-8 |
| MFCD04973619 |
| 4-Amino-5-ethylsulfonyl-2-methoxybenzoic acid |