2,4(1H,3H)-Pyrimidinedione,1-(phenylmethyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,1-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 717-00-0 | Molecular Weight | 202.20900 | |
| Density | 1.278g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 54.86000 |
| LogP | 0.58490 |
| Index of Refraction | 1.604 |
| InChIKey | VYBPQVFJJKEBLA-UHFFFAOYSA-N |
| SMILES | O=c1ccn(Cc2ccccc2)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzyl-1H-pyrimidine-2,4-dione |
| N1-benzyluracil |
| 1-Benzyluracil |
| 1-N-benzyluracil |